cas: 2411440-41-8 — see every product listed under this CAS number, including other names
(S)-2-(5-(Bis(4-chlorophenyl)methyl)-3-methylthiophene-2-carboxamido)-5-guanidinopentanoic acid, 95%, 95% (CAS 2411440-41-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1312XE-1mg |
| cas | 2411440-41-8 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 165.20 Pln | |
| Chemat | 5mg | 328.40 Pln | |
| Chemat | 10mg | 520.40 Pln | |
| Chemat | 25mg | 894.80 Pln | |
| Chemat | 50mg | 1389.20 Pln | |
| Chemat | 100mg | 2210.00 Pln | |
| Chemat | 250mg | 4077.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[5-[bis(4-chlorophenyl)methyl]-3-methylthiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (CAS 2411440-41-8) is a chemical compound with the molecular formula C25H26Cl2N4O3S and a molecular weight of 533.5 g/mol. IUPAC name: (2S)-2-[[5-[bis(4-chlorophenyl)methyl]-3-methylthiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid. InChIKey: OHRIKWUZKGNQKQ-IBGZPJMESA-N.
| Molecular formula | C25H26Cl2N4O3S |
|---|---|
| Molecular weight | 533.5 g/mol |
| IUPAC name | (2S)-2-[[5-[bis(4-chlorophenyl)methyl]-3-methylthiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | OHRIKWUZKGNQKQ-IBGZPJMESA-N |
| SMILES | CC1=C(SC(=C1)C(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)