cas: 147385-61-3 — see every product listed under this CAS number, including other names
(S)-2-Acetamido-N-((S)-1-(((S)-5-guanidino-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)-4-methylpentanamide 2,2,2-trifluoroacetate, 99% (CAS 147385-61-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A691183-100mg |
| cas | 147385-61-3 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 7094.29 Pln |
| purity | 99% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid (CAS 147385-61-3) is a chemical compound with the molecular formula C22H39F3N6O6 and a molecular weight of 540.6 g/mol. IUPAC name: (2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid. InChIKey: WUHGBZVQELGOMH-FRKSIBALSA-N.
| Molecular formula | C22H39F3N6O6 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;2,2,2-trifluoroacetic acid |
| InChIKey | WUHGBZVQELGOMH-FRKSIBALSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)