cas: 24125-16-4 — see every product listed under this CAS number, including other names
(S)-2-Acetamido-N-((S)-1-(((S)-5-guanidino-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)-4-methylpentanamide hydrochloride, 90% (HPLC), 90% (HPLC) (CAS 24125-16-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BG1T-1mg |
| cas | 24125-16-4 |
| size | 1mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 213.20 Pln | |
| Chemat | 5mg | 539.60 Pln |
| purity | 90% (HPLC) |
|---|---|
| delivery time | 3 weeks |
(2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride (CAS 24125-16-4) is a chemical compound with the molecular formula C20H39ClN6O4 and a molecular weight of 463.0 g/mol. IUPAC name: (2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride. InChIKey: OQQYPQNFLLAILR-FRKSIBALSA-N.
| Molecular formula | C20H39ClN6O4 |
|---|---|
| Molecular weight | 463.0 g/mol |
| IUPAC name | (2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride |
| InChIKey | OQQYPQNFLLAILR-FRKSIBALSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.Cl |
Computed by PubChem (NCBI)