cas: 1212863-92-7 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(2-chloro-4-fluorophenyl)ethanol, 98% (CAS 1212863-92-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F780411-100MG |
| cas | 1212863-92-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 549.82 Pln | |
| Fluorochem | 250mg | 778.91 Pln | |
| Fluorochem | 1g | 1976.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-2-(2-chloro-4-fluorophenyl)ethanol (CAS 1212863-92-7) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: (2S)-2-amino-2-(2-chloro-4-fluorophenyl)ethanol. InChIKey: YYOIWLGZZGFMGF-MRVPVSSYSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chloro-4-fluorophenyl)ethanol |
| InChIKey | YYOIWLGZZGFMGF-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)[C@@H](CO)N |
Computed by PubChem (NCBI)