cas: 154006-66-3 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(3-fluorophenyl)acetic acid, 98% (CAS 154006-66-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F762744-1G |
| cas | 154006-66-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 221.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-2-(3-fluorophenyl)acetic acid (CAS 154006-66-3) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: (2S)-2-amino-2-(3-fluorophenyl)acetic acid. InChIKey: LVYBCZIDQKJNFP-ZETCQYMHSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-fluorophenyl)acetic acid |
| InChIKey | LVYBCZIDQKJNFP-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)