(S)-2-Amino-2-(3-fluorophenyl)ethanol, 95%
cas: 325152-98-5 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(3-fluorophenyl)ethanol, 95% (CAS 325152-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F461181-100MG |
| cas | 325152-98-5 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 523.79 Pln | |
| Fluorochem | 5g | 1867.07 Pln | |
| Fluorochem | 10g | 3507.12 Pln | |
| Fluorochem | 25g | 8073.22 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1872.25 Pln | |
| Ambeed | 10g | 3663.37 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 547.61 Pln | |
| BLDpharm | 5g | 2013.76 Pln | |
| BLDpharm | 10g | 3946.41 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-2-amino-2-(3-fluorophenyl)ethanol (CAS 325152-98-5) is a chemical compound with the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. IUPAC name: (2S)-2-amino-2-(3-fluorophenyl)ethanol. InChIKey: ZPXAEESIPIUPTJ-MRVPVSSYSA-N.
| Molecular formula | C8H10FNO |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-fluorophenyl)ethanol |
| InChIKey | ZPXAEESIPIUPTJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@@H](CO)N |
Computed by PubChem (NCBI)