cas: 6027-02-7 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(1H-imidazol-4-yl)propanoic acid dihydrochloride, 98%, 98% (CAS 6027-02-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F47G-5g |
| cas | 6027-02-7 |
| size | 5g |
| availability | 35.02g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 702.80 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 25g | 1648.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;dihydrochloride (CAS 6027-02-7) is a chemical compound with the molecular formula C6H11Cl2N3O2 and a molecular weight of 228.07 g/mol. IUPAC name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;dihydrochloride. InChIKey: XEJCDBUNISUVGZ-XRIGFGBMSA-N.
| Molecular formula | C6H11Cl2N3O2 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;dihydrochloride |
| InChIKey | XEJCDBUNISUVGZ-XRIGFGBMSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)