CAS 2418595-15-8 is the registry number for (S)-2-Amino-5-cyanopentanoic acid hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
(2S)-2-amino-5-cyanopentanoic acid;hydrochloride (CAS 2418595-15-8) is a chemical compound with the molecular formula C6H11ClN2O2 and a molecular weight of 178.62 g/mol. IUPAC name: (2S)-2-amino-5-cyanopentanoic acid;hydrochloride. InChIKey: LIHRUYNHFKZQHC-JEDNCBNOSA-N.
| Molecular formula | C6H11ClN2O2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | (2S)-2-amino-5-cyanopentanoic acid;hydrochloride |
| InChIKey | LIHRUYNHFKZQHC-JEDNCBNOSA-N |
| SMILES | C(CC#N)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)