CAS 1369533-83-4 appears in our catalog under these names: (S)–2–Chloropentanedioic acid, S-2-Chloroglutaric acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g.
(2S)-2-chloropentanedioic acid (CAS 1369533-83-4) is a chemical compound with the molecular formula C5H7ClO4 and a molecular weight of 166.56 g/mol. IUPAC name: (2S)-2-chloropentanedioic acid. InChIKey: KJFNGSHVXRYBEJ-VKHMYHEASA-N.
| Molecular formula | C5H7ClO4 |
|---|---|
| Molecular weight | 166.56 g/mol |
| IUPAC name | (2S)-2-chloropentanedioic acid |
| InChIKey | KJFNGSHVXRYBEJ-VKHMYHEASA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)Cl |
Computed by PubChem (NCBI)