cas: 68906-26-3 — see every product listed under this CAS number, including other names
(S)-2-Methyl-1-phenylpropan-1-amine 98% (CAS 68906-26-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A247977-100mg |
| cas | 68906-26-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A247977 |
(1S)-2-methyl-1-phenylpropan-1-amine (CAS 68906-26-3) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: (1S)-2-methyl-1-phenylpropan-1-amine. InChIKey: UVXXBSCXKKIBCH-JTQLQIEISA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | (1S)-2-methyl-1-phenylpropan-1-amine |
| InChIKey | UVXXBSCXKKIBCH-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)