(S)-2-Phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine, 97%
cas: 1208867-88-2 — see every product listed under this CAS number, including other names
(S)-2-Phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine, 97% (CAS 1208867-88-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1519852-100mg |
| cas | 1208867-88-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| Ambeed | 5g | 5059.56 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 1297.35 Pln | |
| BLDpharm | 5g | 5451.44 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1168.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine (CAS 1208867-88-2) is a chemical compound with the molecular formula C14H11F3N2 and a molecular weight of 264.25 g/mol. IUPAC name: (2S)-2-phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine. InChIKey: HSRBEDJTOVKYFL-GFCCVEGCSA-N.
| Molecular formula | C14H11F3N2 |
|---|---|
| Molecular weight | 264.25 g/mol |
| IUPAC name | (2S)-2-phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine |
| InChIKey | HSRBEDJTOVKYFL-GFCCVEGCSA-N |
| SMILES | C1[C@@H](N=C2N1C=C(C=C2)C(F)(F)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine, (2S)-2,3-Dihydro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine, (2S)-2-phenyl-6-(trifluoromethyl)-2H,3H-imidazo[1,2-a]pyridine, (2S)-2,3-dihydro-2-phenyl-6-(trifluoromethyl)-imidazo[1,2-a]pyridine,, (2S)-2-phenyl-6-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine, (2S)- 2,3-dihydro-2-phenyl-6-(trifluoromethyl)-imidazo[1,2-a]pyridine,, (2S)-2,3-Dihydro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine - [D89110]