cas: 361342-52-1 — see every product listed under this CAS number, including other names
(S)-3,3′-Bis(9-anthryl)-1,1′-binaphthalene-2,2′-diyl hydrogen phosphate, 95%, 95% (CAS 361342-52-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7HN-25mg |
| cas | 361342-52-1 |
| size | 25mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 131.60 Pln | |
| Chemat | 50mg | 155.60 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Chemat | 5g | 3400.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
10,16-di(anthracen-9-yl)-13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (CAS 361342-52-1) is a chemical compound with the molecular formula C48H29O4P and a molecular weight of 700.7 g/mol. IUPAC name: 10,16-di(anthracen-9-yl)-13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide. InChIKey: QYJHYRSRVCOHMY-UHFFFAOYSA-N.
| Molecular formula | C48H29O4P |
|---|---|
| Molecular weight | 700.7 g/mol |
| IUPAC name | 10,16-di(anthracen-9-yl)-13-hydroxy-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| InChIKey | QYJHYRSRVCOHMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C4=CC5=CC=CC=C5C6=C4OP(=O)(OC7=C6C8=CC=CC=C8C=C7C9=C1C=CC=CC1=CC1=CC=CC=C19)O |
Computed by PubChem (NCBI)