cas: 270596-37-7 — see every product listed under this CAS number, including other names
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2-chlorophenyl)butanoic acid, 98%, 98% (CAS 270596-37-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCWI-50mg |
| cas | 270596-37-7 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 170.00 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 707.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-4-(2-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 270596-37-7) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (3S)-4-(2-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: RTGMPAHEDKUNFP-KRWDZBQOSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (3S)-4-(2-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | RTGMPAHEDKUNFP-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)