cas: 908601-15-0 — see every product listed under this CAS number, including other names
(S)-3-((S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-(tert-butoxycarbonyl)-1H-indol-3-yl)propanoyl)-2,2-dimethyloxazolidine-5-carboxylic acid, 98%, 98% (CAS 908601-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTMW-1g |
| cas | 908601-15-0 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2066.00 Pln | |
| Chemat | 10g | 3174.80 Pln | |
| Chemat | 25g | 6275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 908601-15-0) is a chemical compound with the molecular formula C37H39N3O8 and a molecular weight of 653.7 g/mol. IUPAC name: 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: BVOXZEOINKCAMZ-UHFFFAOYSA-N.
| Molecular formula | C37H39N3O8 |
|---|---|
| Molecular weight | 653.7 g/mol |
| IUPAC name | 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | BVOXZEOINKCAMZ-UHFFFAOYSA-N |
| SMILES | CC1(N(C(CO1)C(=O)O)C(=O)C(CC2=CN(C3=CC=CC=C32)C(=O)OC(C)(C)C)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46)C |
Computed by PubChem (NCBI)