cas: 500770-74-1 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(3-chlorophenyl)propanoic acid, 98% (CAS 500770-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241475-100MG |
| cas | 500770-74-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1684.84 Pln | |
| Fluorochem | 10g | 3064.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500770-74-1) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: (3S)-3-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UDUKZORPLJUWTF-NSHDSACASA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | (3S)-3-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UDUKZORPLJUWTF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)