cas: 1391469-10-5 — see every product listed under this CAS number, including other names
(S)-3-(4-Fluorophenyl)morpholine hydrochloride 97% (CAS 1391469-10-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198157-100mg |
| cas | 1391469-10-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A198157 |
(3S)-3-(4-fluorophenyl)morpholine;hydrochloride (CAS 1391469-10-5) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: (3S)-3-(4-fluorophenyl)morpholine;hydrochloride. InChIKey: WMGZVNCXNNRNNF-HNCPQSOCSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | (3S)-3-(4-fluorophenyl)morpholine;hydrochloride |
| InChIKey | WMGZVNCXNNRNNF-HNCPQSOCSA-N |
| SMILES | C1COC[C@@H](N1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)