cas: 199175-10-5 — see every product listed under this CAS number, including other names
(S)-3-(Aminomethyl)-1-N-Boc-pyrrolidine, 97% (CAS 199175-10-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011391-1G |
| cas | 199175-10-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 581.06 Pln | |
| Fluorochem | 10g | 1080.89 Pln | |
| Fluorochem | 25g | 2059.71 Pln | |
| Fluorochem | 100g | 8057.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (3S)-3-(aminomethyl)pyrrolidine-1-carboxylate (CAS 199175-10-5) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)pyrrolidine-1-carboxylate. InChIKey: OGCCBDIYOAFOGK-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)pyrrolidine-1-carboxylate |
| InChIKey | OGCCBDIYOAFOGK-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CN |
Computed by PubChem (NCBI)