cas: 371240-55-0 — see every product listed under this CAS number, including other names
(S)-3-(Toluene-4-sulfonyloxy)-pyrrolidine-1-carboxylic acid tert-butyl ester, 95% (CAS 371240-55-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F087330-250MG |
| cas | 371240-55-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1216.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (CAS 371240-55-0) is a chemical compound with the molecular formula C16H23NO5S and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate. InChIKey: MWACHFODPQVXHF-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO5S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| InChIKey | MWACHFODPQVXHF-ZDUSSCGKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)