cas: 216854-23-8 — see every product listed under this CAS number, including other names
(S)-3-Boc-aminopiperidine, 99.96% (CAS 216854-23-8) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 50 g, 100 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-40028-25 g |
| cas | 216854-23-8 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 287.18 Pln | |
| MedChemExpress | 50 g | 407.93 Pln | |
| MedChemExpress | 100 g | 621.55 Pln | |
| MedChemExpress | 10mM/1mL | 301.12 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.96% |
Tert-butyl N-[(3S)-piperidin-3-yl]carbamate (CAS 216854-23-8) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(3S)-piperidin-3-yl]carbamate. InChIKey: WUOQXNWMYLFAHT-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(3S)-piperidin-3-yl]carbamate |
| InChIKey | WUOQXNWMYLFAHT-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCNC1 |
Computed by PubChem (NCBI)