(S)-4-((S)-sec-Butyl)-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole, 97%
cas: 2634687-75-3 — see every product listed under this CAS number, including other names
(S)-4-((S)-sec-Butyl)-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole, 97% (CAS 2634687-75-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1352029-50mg |
| cas | 2634687-75-3 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 375.94 Pln | |
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 1115.75 Pln | |
| Ambeed | 1g | 3173.88 Pln | |
| BLDpharm | 50mg | 403.22 Pln | |
| BLDpharm | 100mg | 625.36 Pln | |
| BLDpharm | 250mg | 1197.38 Pln | |
| BLDpharm | 1g | 3418.82 Pln | |
| Chemat | 50mg | 390.80 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 3482.00 Pln | |
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 1148.57 Pln | |
| Fluorochem | 1g | 3199.93 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (CAS 2634687-75-3) is a chemical compound with the molecular formula C25H26NOP and a molecular weight of 387.5 g/mol. IUPAC name: [2-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane. InChIKey: JHDSMMAHIVXAPW-WMZHIEFXSA-N.
| Molecular formula | C25H26NOP |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | [2-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| InChIKey | JHDSMMAHIVXAPW-WMZHIEFXSA-N |
| SMILES | CC[C@H](C)[C@H]1COC(=N1)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)