cas: 1196713-21-9 — see every product listed under this CAS number, including other names
(S)-4-(Piperidin-3-yl)aniline, 95%, 95% (CAS 1196713-21-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PF9-50mg |
| cas | 1196713-21-9 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 664.40 Pln | |
| Chemat | 100mg | 1082.00 Pln | |
| Chemat | 250mg | 1797.20 Pln | |
| Chemat | 1g | 4744.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[(3S)-piperidin-3-yl]aniline (CAS 1196713-21-9) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: 4-[(3S)-piperidin-3-yl]aniline. InChIKey: COUOFYDJUDASPJ-SNVBAGLBSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 4-[(3S)-piperidin-3-yl]aniline |
| InChIKey | COUOFYDJUDASPJ-SNVBAGLBSA-N |
| SMILES | C1C[C@H](CNC1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)