(S)-4-(tert-Butyl)-2-(2-(2-(diphenylphosphino)phenyl)propan-2-yl)-4,5-dihydrooxazole, 97%
cas: 947618-07-7 — see every product listed under this CAS number, including other names
(S)-4-(tert-Butyl)-2-(2-(2-(diphenylphosphino)phenyl)propan-2-yl)-4,5-dihydrooxazole, 97% (CAS 947618-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1475115-100mg |
| cas | 947618-07-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2005.75 Pln | |
| Ambeed | 5g | 7835.25 Pln | |
| BLDpharm | 50mg | 453.20 Pln | |
| BLDpharm | 100mg | 636.47 Pln | |
| BLDpharm | 250mg | 914.15 Pln | |
| BLDpharm | 1g | 2158.15 Pln | |
| BLDpharm | 5g | 8439.28 Pln | |
| Chemat | 50mg | 424.40 Pln | |
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2094.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phenyl]-diphenylphosphane (CAS 947618-07-7) is a chemical compound with the molecular formula C28H32NOP and a molecular weight of 429.5 g/mol. IUPAC name: [2-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phenyl]-diphenylphosphane. InChIKey: HBJSADZQXYZTTQ-RUZDIDTESA-N.
| Molecular formula | C28H32NOP |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | [2-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]phenyl]-diphenylphosphane |
| InChIKey | HBJSADZQXYZTTQ-RUZDIDTESA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C(C)(C)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)