Products 404844-77-5
CAS 404844-77-5 appears in our catalog under these names: (S)-4-(tert-Butyl)-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97%, 97%, (S)-4-(tert-Butyl)-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4S)-4-tert-butyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole (CAS 404844-77-5) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: (4S)-4-tert-butyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole. InChIKey: YKNHIUJACDFJGE-LLVKDONJSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | (4S)-4-tert-butyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | YKNHIUJACDFJGE-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)CC2=CC=CC=N2 |
Computed by PubChem (NCBI)