cas: 314741-40-7 — see every product listed under this CAS number, including other names
(S)-4-N-Boc-2-Hydroxymethyl-piperazine, 96% (CAS 314741-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034408-250MG |
| cas | 314741-40-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 487.35 Pln | |
| Fluorochem | 100g | 1450.55 Pln | |
| Fluorochem | 500g | 5579.30 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate (CAS 314741-40-7) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: NSILYQWHARROMG-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3S)-3-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | NSILYQWHARROMG-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)CO |
Computed by PubChem (NCBI)