cas: 125572-93-2 — see every product listed under this CAS number, including other names
(S)-5,6,7,8-Tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-1-naphthalenol hydrochloride, 99%, 99% (CAS 125572-93-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NWS-5mg |
| cas | 125572-93-2 |
| size | 5mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 246.80 Pln | |
| Chemat | 10mg | 309.20 Pln | |
| Chemat | 25mg | 342.80 Pln | |
| Chemat | 50mg | 376.40 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 1163.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride (CAS 125572-93-2) is a chemical compound with the molecular formula C19H26ClNOS and a molecular weight of 351.9 g/mol. IUPAC name: (6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride. InChIKey: CEXBONHIOKGWNU-NTISSMGPSA-N.
| Molecular formula | C19H26ClNOS |
|---|---|
| Molecular weight | 351.9 g/mol |
| IUPAC name | (6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol;hydrochloride |
| InChIKey | CEXBONHIOKGWNU-NTISSMGPSA-N |
| SMILES | CCCN(CCC1=CC=CS1)[C@H]2CCC3=C(C2)C=CC=C3O.Cl |
Computed by PubChem (NCBI)