(S)-5-Benzyl-2-(perfluorophenyl)-2,5,6,8-tetrahydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate, 95%
cas: 1327274-33-8 — see every product listed under this CAS number, including other names
(S)-5-Benzyl-2-(perfluorophenyl)-2,5,6,8-tetrahydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate, 95% (CAS 1327274-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A316028-100mg |
| cas | 1327274-33-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1844.44 Pln | |
| Ambeed | 5g | 7162.19 Pln | |
| BLDpharm | 50mg | 225.50 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 547.61 Pln | |
| BLDpharm | 1g | 1980.44 Pln | |
| BLDpharm | 5g | 7717.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(5S)-5-benzyl-2-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate (CAS 1327274-33-8) is a chemical compound with the molecular formula C18H13BF9N3O and a molecular weight of 469.1 g/mol. IUPAC name: (5S)-5-benzyl-2-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate. InChIKey: YCLQFLWNWVBBTP-MERQFXBCSA-N.
| Molecular formula | C18H13BF9N3O |
|---|---|
| Molecular weight | 469.1 g/mol |
| IUPAC name | (5S)-5-benzyl-2-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate |
| InChIKey | YCLQFLWNWVBBTP-MERQFXBCSA-N |
| SMILES | [B-](F)(F)(F)F.C1[C@@H]([N+]2=CN(N=C2CO1)C3=C(C(=C(C(=C3F)F)F)F)F)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)