(S)-5-Benzyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97%
cas: 960254-94-8 — see every product listed under this CAS number, including other names
(S)-5-Benzyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-2-ium tetrafluoroborate, 97% (CAS 960254-94-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1219971-100mg |
| cas | 960254-94-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2639.88 Pln | |
| BLDpharm | 100mg | 653.13 Pln | |
| BLDpharm | 250mg | 1086.31 Pln | |
| BLDpharm | 1g | 2841.25 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1662.80 Pln | |
| Chemat | 5g | 8061.20 Pln | |
| Fluorochem | 100mg | 622.72 Pln | |
| Fluorochem | 250mg | 1044.44 Pln | |
| Fluorochem | 1g | 2726.14 Pln | |
| Fluorochem | 5g | 11639.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(5S)-5-benzyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate (CAS 960254-94-8) is a chemical compound with the molecular formula C18H18BF4N3 and a molecular weight of 363.2 g/mol. IUPAC name: (5S)-5-benzyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate. InChIKey: BYNZPPBHTLSTBG-LMOVPXPDSA-N.
| Molecular formula | C18H18BF4N3 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | (5S)-5-benzyl-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate |
| InChIKey | BYNZPPBHTLSTBG-LMOVPXPDSA-N |
| SMILES | [B-](F)(F)(F)F.C1CC2=NN(C=[N+]2[C@@H]1CC3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)