(S)-5-isopropyl-2-(perfluorophenyl)-2,5,6,8-tetrahydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate, 97%
cas: 1431323-18-0 — see every product listed under this CAS number, including other names
(S)-5-isopropyl-2-(perfluorophenyl)-2,5,6,8-tetrahydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate, 97% (CAS 1431323-18-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A427278-100mg |
| cas | 1431323-18-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 2250.50 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 692.00 Pln | |
| BLDpharm | 1g | 2435.83 Pln | |
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1408.40 Pln | |
| Chemat | 5g | 5910.80 Pln | |
| Chemat | 10g | 9947.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(5S)-2-(2,3,4,5,6-pentafluorophenyl)-5-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate (CAS 1431323-18-0) is a chemical compound with the molecular formula C14H13BF9N3O and a molecular weight of 421.07 g/mol. IUPAC name: (5S)-2-(2,3,4,5,6-pentafluorophenyl)-5-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate. InChIKey: CUTKEDUAINFAJX-OGFXRTJISA-N.
| Molecular formula | C14H13BF9N3O |
|---|---|
| Molecular weight | 421.07 g/mol |
| IUPAC name | (5S)-2-(2,3,4,5,6-pentafluorophenyl)-5-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium tetrafluoroborate |
| InChIKey | CUTKEDUAINFAJX-OGFXRTJISA-N |
| SMILES | [B-](F)(F)(F)F.CC(C)[C@H]1COCC2=NN(C=[N+]12)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)