(S)-6,6'-Bis(bis(3,5-bis(trimethylsilyl)phenyl)phosphino)-2,2',3,3'-tetrahydro-5,5'-bibenzo[b][1,4]dioxine, 98%
cas: 2757287-32-2 — see every product listed under this CAS number, including other names
(S)-6,6'-Bis(bis(3,5-bis(trimethylsilyl)phenyl)phosphino)-2,2',3,3'-tetrahydro-5,5'-bibenzo[b][1,4]dioxine, 98% (CAS 2757287-32-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F864899-50MG |
| cas | 2757287-32-2 |
| size | 50mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 919.49 Pln | |
| Fluorochem | 100mg | 1497.41 Pln | |
| Fluorochem | 250mg | 2476.23 Pln | |
| Fluorochem | 1g | 5527.24 Pln | |
| Ambeed | 250mg | 1649.75 Pln | |
| Ambeed | 1g | 3713.44 Pln | |
| Ambeed | 5g | 14654.88 Pln | |
| Chemat | 50mg | 635.60 Pln | |
| Chemat | 100mg | 1034.00 Pln | |
| Chemat | 250mg | 1710.80 Pln | |
| Chemat | 1g | 3856.40 Pln | |
| BLDpharm | 50mg | 614.25 Pln | |
| BLDpharm | 100mg | 980.79 Pln | |
| BLDpharm | 250mg | 1619.45 Pln | |
| BLDpharm | 1g | 3640.96 Pln | |
| BLDpharm | 5g | 14359.41 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
[5-[6-bis[3,5-bis(trimethylsilyl)phenyl]phosphanyl-2,3-dihydro-1,4-benzodioxin-5-yl]-2,3-dihydro-1,4-benzodioxin-6-yl]-bis[3,5-bis(trimethylsilyl)phenyl]phosphane (CAS 2757287-32-2) is a chemical compound with the molecular formula C64H96O4P2Si8 and a molecular weight of 1216.1 g/mol. IUPAC name: [5-[6-bis[3,5-bis(trimethylsilyl)phenyl]phosphanyl-2,3-dihydro-1,4-benzodioxin-5-yl]-2,3-dihydro-1,4-benzodioxin-6-yl]-bis[3,5-bis(trimethylsilyl)phenyl]phosphane. InChIKey: SKIVRCGPQONSPK-UHFFFAOYSA-N.
| Molecular formula | C64H96O4P2Si8 |
|---|---|
| Molecular weight | 1216.1 g/mol |
| IUPAC name | [5-[6-bis[3,5-bis(trimethylsilyl)phenyl]phosphanyl-2,3-dihydro-1,4-benzodioxin-5-yl]-2,3-dihydro-1,4-benzodioxin-6-yl]-bis[3,5-bis(trimethylsilyl)phenyl]phosphane |
| InChIKey | SKIVRCGPQONSPK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC(=CC(=C1)P(C2=C(C3=C(C=C2)OCCO3)C4=C(C=CC5=C4OCCO5)P(C6=CC(=CC(=C6)[Si](C)(C)C)[Si](C)(C)C)C7=CC(=CC(=C7)[Si](C)(C)C)[Si](C)(C)C)C8=CC(=CC(=C8)[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
starbld0043312, C64H96O4P2Si8