cas: 1228548-44-4 — see every product listed under this CAS number, including other names
(S)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine 95% (CAS 1228548-44-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A841803-100mg |
| cas | 1228548-44-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1099.06 Pln | |
| Ambeed | 5g | 3746.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A841803 |
(1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1228548-44-4) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: (1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: JKGNIZNLBBLURY-JTQLQIEISA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | JKGNIZNLBBLURY-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)