cas: 718611-17-7 — see every product listed under this CAS number, including other names
(S)-Boc-3-Amino-3-phenylpropan-1-ol 97% (CAS 718611-17-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102542-250mg |
| cas | 718611-17-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 893.25 Pln | |
| Ambeed | 10g | 1505.12 Pln | |
| Ambeed | 25g | 2489.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A102542 |
Tert-butyl N-[(1S)-3-hydroxy-1-phenylpropyl]carbamate (CAS 718611-17-7) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl N-[(1S)-3-hydroxy-1-phenylpropyl]carbamate. InChIKey: SMEMODSNLZWKBF-LBPRGKRZSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl N-[(1S)-3-hydroxy-1-phenylpropyl]carbamate |
| InChIKey | SMEMODSNLZWKBF-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO)C1=CC=CC=C1 |
Computed by PubChem (NCBI)