(S)-Ethyl 2-(3,5-dichloro-2-hydroxy-4-(2-(4-methylpiperazin-1-yl)ethoxy)benzamido)-3-phenylpropanoate hydrochloride, 98%
cas: 2757697-75-7 — see every product listed under this CAS number, including other names
(S)-Ethyl 2-(3,5-dichloro-2-hydroxy-4-(2-(4-methylpiperazin-1-yl)ethoxy)benzamido)-3-phenylpropanoate hydrochloride, 98% (CAS 2757697-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1378782-250mg |
| cas | 2757697-75-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1160.25 Pln | |
| Ambeed | 1g | 3307.38 Pln | |
| Chemat | 25mg | 304.40 Pln | |
| Chemat | 50mg | 472.40 Pln | |
| Chemat | 100mg | 755.60 Pln | |
| Chemat | 250mg | 1240.40 Pln | |
| Chemat | 1g | 4773.20 Pln | |
| BLDpharm | 25mg | 286.59 Pln | |
| BLDpharm | 50mg | 447.64 Pln | |
| BLDpharm | 100mg | 697.56 Pln | |
| BLDpharm | 250mg | 1136.29 Pln | |
| BLDpharm | 1g | 3563.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]amino]-3-phenylpropanoate;hydrochloride (CAS 2757697-75-7) is a chemical compound with the molecular formula C25H32Cl3N3O5 and a molecular weight of 560.9 g/mol. IUPAC name: ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]amino]-3-phenylpropanoate;hydrochloride. InChIKey: UFZBIFFQQLANIW-BDQAORGHSA-N.
| Molecular formula | C25H32Cl3N3O5 |
|---|---|
| Molecular weight | 560.9 g/mol |
| IUPAC name | ethyl (2S)-2-[[3,5-dichloro-2-hydroxy-4-[2-(4-methylpiperazin-1-yl)ethoxy]benzoyl]amino]-3-phenylpropanoate;hydrochloride |
| InChIKey | UFZBIFFQQLANIW-BDQAORGHSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=CC(=C(C(=C2O)Cl)OCCN3CCN(CC3)C)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
C25H32Cl3N3O5