CAS 138472-22-7 appears in our catalog under these names: (S)-Fmoc-phenylalanine-4-sulfonic acid, 98%, 98%, (S)-Fmoc-phenylalanine-4-sulfonic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfophenyl)propanoic acid (CAS 138472-22-7) is a chemical compound with the molecular formula C24H21NO7S and a molecular weight of 467.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfophenyl)propanoic acid. InChIKey: KWAQABOTKLHIEO-QFIPXVFZSA-N.
| Molecular formula | C24H21NO7S |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfophenyl)propanoic acid |
| InChIKey | KWAQABOTKLHIEO-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)S(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)