cas: 178734-54-8 — see every product listed under this CAS number, including other names
(S)-Methyl 2-((S)-2-((tert-butoxycarbonyl)(methyl)amino)propanamido)-3-methylbutanoate, 95%, 95% (CAS 178734-54-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11370L-250mg |
| cas | 178734-54-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-3-methyl-2-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]amino]butanoate (CAS 178734-54-8) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]amino]butanoate. InChIKey: DCLUDDQQOOVPLD-QWRGUYRKSA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]amino]butanoate |
| InChIKey | DCLUDDQQOOVPLD-QWRGUYRKSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C(C)C)C(=O)OC)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)