(S)-Methyl 2-amino-3-(tritylthio)propanoate, 95%
cas: 115545-85-2 — see every product listed under this CAS number, including other names
(S)-Methyl 2-amino-3-(tritylthio)propanoate, 95% (CAS 115545-85-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A341489-250mg |
| cas | 115545-85-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 893.25 Pln | |
| Ambeed | 5g | 2956.94 Pln | |
| Ambeed | 10g | 4692.44 Pln | |
| Fluorochem | 10g | 5771.94 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 880.83 Pln | |
| BLDpharm | 5g | 2902.34 Pln | |
| BLDpharm | 10g | 4601.74 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 582.80 Pln | |
| Chemat | 5g | 1874.00 Pln | |
| Chemat | 10g | 3112.40 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1075.68 Pln | |
| Fluorochem | 5g | 3460.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-2-amino-3-tritylsulfanylpropanoate (CAS 115545-85-2) is a chemical compound with the molecular formula C23H23NO2S and a molecular weight of 377.5 g/mol. IUPAC name: methyl (2S)-2-amino-3-tritylsulfanylpropanoate. InChIKey: DXUZZMIANHJYIU-OAQYLSRUSA-N.
| Molecular formula | C23H23NO2S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-tritylsulfanylpropanoate |
| InChIKey | DXUZZMIANHJYIU-OAQYLSRUSA-N |
| SMILES | COC(=O)[C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 2-amino-3-(tritylthio)propanoate, S-Trityl-D-cysteine methyl ester, D-Cysteine, S-(triphenylmethyl)-, methyl ester, methyl (2S)-2-amino-3-tritylsulfanylpropanoate, methyl S-trityl-D-cysteinate, (S)-Methyl2-amino-3-(tritylthio)propanoate, methyl (2S)-2-amino-3-tritylsulfanyl-propanoate