cas: 17279-31-1 — see every product listed under this CAS number, including other names
(S)-N,N-Dimethyl-1-phenylethanamine 98% (CAS 17279-31-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A431408-250mg |
| cas | 17279-31-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 965.56 Pln | |
| Ambeed | 25g | 3346.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A431408 |
(1S)-N,N-dimethyl-1-phenylethanamine (CAS 17279-31-1) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: (1S)-N,N-dimethyl-1-phenylethanamine. InChIKey: BVURNMLGDQYNAF-VIFPVBQESA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | (1S)-N,N-dimethyl-1-phenylethanamine |
| InChIKey | BVURNMLGDQYNAF-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N(C)C |
Computed by PubChem (NCBI)