cas: 150407-69-5 — see every product listed under this CAS number, including other names
(S)-N-4-Boc-N-1-Cbz-2-Piperazine carboxylic acid, 97% (CAS 150407-69-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034490-250MG |
| cas | 150407-69-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 2861.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid (CAS 150407-69-5) is a chemical compound with the molecular formula C18H24N2O6 and a molecular weight of 364.4 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid. InChIKey: MKXMXZZARNRMMQ-AWEZNQCLSA-N.
| Molecular formula | C18H24N2O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| InChIKey | MKXMXZZARNRMMQ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)