cas: 1893408-11-1 — see every product listed under this CAS number, including other names
(S)-Tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate, 97% (CAS 1893408-11-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624149-1G |
| cas | 1893408-11-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 2663.66 Pln | |
| Fluorochem | 10g | 4402.63 Pln | |
| Fluorochem | 25g | 8562.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate (CAS 1893408-11-1) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: GISYXRBCSOIMTM-ZETCQYMHSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | GISYXRBCSOIMTM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C(C1)(F)F)O |
Computed by PubChem (NCBI)