cas: 228422-49-9 — see every product listed under this CAS number, including other names
(S)-beta-(4-Fluorophenyl)alaninol, 97% (CAS 228422-49-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040274-250MG |
| cas | 228422-49-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 2106.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-3-amino-3-(4-fluorophenyl)propan-1-ol (CAS 228422-49-9) is a chemical compound with the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. IUPAC name: (3S)-3-amino-3-(4-fluorophenyl)propan-1-ol. InChIKey: CCJPLYPJQZYBLI-VIFPVBQESA-N.
| Molecular formula | C9H12FNO |
|---|---|
| Molecular weight | 169.20 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-fluorophenyl)propan-1-ol |
| InChIKey | CCJPLYPJQZYBLI-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1[C@H](CCO)N)F |
Computed by PubChem (NCBI)