cas: 927652-04-8 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (3-methylpyrrolidin-3-yl)carbamate, 95%, 95% (CAS 927652-04-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H1YE-100mg |
| cas | 927652-04-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1034.00 Pln | |
| Chemat | 1g | 2426.00 Pln | |
| Chemat | 500mg | 1917.20 Pln | |
| Chemat | 5g | 9251.60 Pln | |
| Chemat | 10g | 15381.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3S)-3-methylpyrrolidin-3-yl]carbamate (CAS 927652-04-8) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(3S)-3-methylpyrrolidin-3-yl]carbamate. InChIKey: DIQWSFWWYVRXRO-JTQLQIEISA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(3S)-3-methylpyrrolidin-3-yl]carbamate |
| InChIKey | DIQWSFWWYVRXRO-JTQLQIEISA-N |
| SMILES | C[C@@]1(CCNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)