cas: 167298-40-0 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (3-oxocyclopentyl)carbamate 95% (CAS 167298-40-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A255975-100mg |
| cas | 167298-40-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 3107.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A255975 |
Tert-butyl N-[(1S)-3-oxocyclopentyl]carbamate (CAS 167298-40-0) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: tert-butyl N-[(1S)-3-oxocyclopentyl]carbamate. InChIKey: CLOXAWYNXXEWBT-ZETCQYMHSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | tert-butyl N-[(1S)-3-oxocyclopentyl]carbamate |
| InChIKey | CLOXAWYNXXEWBT-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC(=O)C1 |
Computed by PubChem (NCBI)