cas: 2061996-90-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(3-bromophenyl)pyrrolidine-1-carboxylate 95% (CAS 2061996-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A257332-100mg |
| cas | 2061996-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2117.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A257332 |
Tert-butyl (2S)-2-(3-bromophenyl)pyrrolidine-1-carboxylate (CAS 2061996-90-3) is a chemical compound with the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. IUPAC name: tert-butyl (2S)-2-(3-bromophenyl)pyrrolidine-1-carboxylate. InChIKey: JNCUUJFKWXBYTB-ZDUSSCGKSA-N.
| Molecular formula | C15H20BrNO2 |
|---|---|
| Molecular weight | 326.23 g/mol |
| IUPAC name | tert-butyl (2S)-2-(3-bromophenyl)pyrrolidine-1-carboxylate |
| InChIKey | JNCUUJFKWXBYTB-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)