cas: 75190-94-2 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-aminobutanoate, 95% (CAS 75190-94-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A890916-5g |
| cas | 75190-94-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7888.51 Pln | |
| Fluorochem | 1g | 2320.03 Pln | |
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 1605.20 Pln | |
| BLDpharm | 100mg | 741.99 Pln | |
| BLDpharm | 250mg | 1125.18 Pln | |
| BLDpharm | 1g | 2180.37 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (2S)-2-aminobutanoate (CAS 75190-94-2) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: tert-butyl (2S)-2-aminobutanoate. InChIKey: UZHNWSLHLJLEAZ-LURJTMIESA-N.
| Molecular formula | C8H17NO2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | tert-butyl (2S)-2-aminobutanoate |
| InChIKey | UZHNWSLHLJLEAZ-LURJTMIESA-N |
| SMILES | CC[C@@H](C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)