cas: 384829-99-6 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-(iodomethyl)piperidine-1-carboxylate, 97% (CAS 384829-99-6) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F615244-500MG |
| cas | 384829-99-6 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1403.69 Pln | |
| Fluorochem | 1g | 2132.60 Pln | |
| Fluorochem | 5g | 6386.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-(iodomethyl)piperidine-1-carboxylate (CAS 384829-99-6) is a chemical compound with the molecular formula C11H20INO2 and a molecular weight of 325.19 g/mol. IUPAC name: tert-butyl (3S)-3-(iodomethyl)piperidine-1-carboxylate. InChIKey: GWYLEGFCHNTQTF-SECBINFHSA-N.
| Molecular formula | C11H20INO2 |
|---|---|
| Molecular weight | 325.19 g/mol |
| IUPAC name | tert-butyl (3S)-3-(iodomethyl)piperidine-1-carboxylate |
| InChIKey | GWYLEGFCHNTQTF-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)CI |
Computed by PubChem (NCBI)