cas: 77215-55-5 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-amino-2-(((benzyloxy)carbonyl)amino)propanoate, 95%, 95% (CAS 77215-55-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147HF-100mg |
| cas | 77215-55-5 |
| size | 100mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 1163.60 Pln | |
| Chemat | 100g | 3717.20 Pln | |
| Chemat | 500g | 14750.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoate (CAS 77215-55-5) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: tert-butyl (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: GUTOOFAUODQZRP-LBPRGKRZSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | tert-butyl (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | GUTOOFAUODQZRP-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CN)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)