cas: 215918-21-1 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate, 97%, 97% (CAS 215918-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CG37-100mg |
| cas | 215918-21-1 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 798.80 Pln | |
| Chemat | 5g | 2272.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 215918-21-1) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (2S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: KQLZXWXCBWPDAD-ZETCQYMHSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (2S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | KQLZXWXCBWPDAD-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@H]1CO)(F)F |
Computed by PubChem (NCBI)