(S)-tert-Butyl piperidine-2-carboxylate, 97%
cas: 118143-76-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl piperidine-2-carboxylate, 97% (CAS 118143-76-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A765668-250mg |
| cas | 118143-76-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 1944.56 Pln | |
| Ambeed | 10g | 3257.31 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1787.60 Pln | |
| Chemat | 10g | 2997.20 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 597.59 Pln | |
| BLDpharm | 5g | 1908.24 Pln | |
| BLDpharm | 10g | 3196.68 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2S)-piperidine-2-carboxylate (CAS 118143-76-3) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: tert-butyl (2S)-piperidine-2-carboxylate. InChIKey: MESKMUAFJDWOAR-QMMMGPOBSA-N.
| Molecular formula | C10H19NO2 |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | tert-butyl (2S)-piperidine-2-carboxylate |
| InChIKey | MESKMUAFJDWOAR-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCCN1 |
Computed by PubChem (NCBI)
Synonyms:
(S)-tert-Butyl piperidine-2-carboxylate, tert-butyl (2S)-piperidine-2-carboxylate, 2-Piperidinecarboxylic acid, 1,1-dimethylethyl ester, (2S)-, tert-Butyl (S)-piperidine-2-carboxylate, (S)-piperidine-2-carboxylic acid tert-butyl ester, MESKMUAFJDWOAR-QMMMGPOBSA-N, (S)-tert-Butylpiperidine-2-carboxylate