cas: 1189152-81-5 — see every product listed under this CAS number, including other names
(S)-tert-butyl 2-(4-bromophenyl)pyrrolidine-1-carboxylate, 97%, 97% (CAS 1189152-81-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11082E-250mg |
| cas | 1189152-81-5 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1672.40 Pln | |
| Chemat | 100mg | 1134.80 Pln | |
| Chemat | 500mg | 2958.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-(4-bromophenyl)pyrrolidine-1-carboxylate (CAS 1189152-81-5) is a chemical compound with the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. IUPAC name: tert-butyl (2S)-2-(4-bromophenyl)pyrrolidine-1-carboxylate. InChIKey: PZDPUQUIZKCNOF-ZDUSSCGKSA-N.
| Molecular formula | C15H20BrNO2 |
|---|---|
| Molecular weight | 326.23 g/mol |
| IUPAC name | tert-butyl (2S)-2-(4-bromophenyl)pyrrolidine-1-carboxylate |
| InChIKey | PZDPUQUIZKCNOF-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)