(S,S)-BaryPhos, 97%
cas: 2416226-68-9 — see every product listed under this CAS number, including other names
(S,S)-BaryPhos, 97% (CAS 2416226-68-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12LKAW-25mg |
| cas | 2416226-68-9 |
| size | 25mg |
| availability | 2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 424.40 Pln | |
| Chemat | 50mg | 568.40 Pln | |
| Chemat | 100mg | 798.80 Pln | |
| Chemat | 250mg | 1907.60 Pln | |
| Chemat | 500mg | 3755.60 Pln | |
| Chemat | 1g | 7442.00 Pln | |
| Fluorochem | 50mg | 700.81 Pln | |
| Fluorochem | 100mg | 976.76 Pln | |
| Fluorochem | 250mg | 2278.38 Pln | |
| Fluorochem | 1g | 8671.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[(2S,3S)-3-tert-butyl-4-(3,5-dicyclopentyl-2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]propan-2-ol (CAS 2416226-68-9) is a chemical compound with the molecular formula C32H45O4P and a molecular weight of 524.7 g/mol. IUPAC name: 2-[(2S,3S)-3-tert-butyl-4-(3,5-dicyclopentyl-2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]propan-2-ol. InChIKey: CHOYNURMAGXWEY-WLFXDIPCSA-N.
| Molecular formula | C32H45O4P |
|---|---|
| Molecular weight | 524.7 g/mol |
| IUPAC name | 2-[(2S,3S)-3-tert-butyl-4-(3,5-dicyclopentyl-2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphol-2-yl]propan-2-ol |
| InChIKey | CHOYNURMAGXWEY-WLFXDIPCSA-N |
| SMILES | CC(C)(C)[P@@]1[C@H](OC2=CC=CC(=C21)C3=C(C(=CC(=C3OC)C4CCCC4)C5CCCC5)OC)C(C)(C)O |
Computed by PubChem (NCBI)