cas: 188264-84-8 — see every product listed under this CAS number, including other names
(S,S)-Co(salen) 99% (CAS 188264-84-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160042-500g |
| cas | 188264-84-8 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 3841.38 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 1010.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160042 |
Cobalt(2+);2,4-ditert-butyl-6-[[(1S,2S)-2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]cyclohexyl]iminomethyl]phenolate (CAS 188264-84-8) is a chemical compound with the molecular formula C36H52CoN2O2 and a molecular weight of 603.7 g/mol. IUPAC name: cobalt(2+);2,4-ditert-butyl-6-[[(1S,2S)-2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]cyclohexyl]iminomethyl]phenolate. InChIKey: ZFWPDJKMASHRPT-PNHSAAKESA-L.
| Molecular formula | C36H52CoN2O2 |
|---|---|
| Molecular weight | 603.7 g/mol |
| IUPAC name | cobalt(2+);2,4-ditert-butyl-6-[[(1S,2S)-2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]cyclohexyl]iminomethyl]phenolate |
| InChIKey | ZFWPDJKMASHRPT-PNHSAAKESA-L |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)[O-])C=N[C@H]2CCCC[C@@H]2N=CC3=C(C(=CC(=C3)C(C)(C)C)C(C)(C)C)[O-].[Co+2] |
Computed by PubChem (NCBI)